C14H19N — CID 105453912
(1R)-2-cyclobutyl-2-(3-methylphenyl)cyclopropan-1-amine (PubChem CID 105453912) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1R)-2-cyclobutyl-2-(3-methylphenyl)cyclopropan-1-amine.
| Compound Name | (1R)-2-cyclobutyl-2-(3-methylphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 105453912 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1R)-2-cyclobutyl-2-(3-methylphenyl)cyclopropan-1-amine |
| SMILES | Cc1cccc(C2(C3CCC3)C[C@H]2N)c1 |
| InChI | InChI=1S/C14H19N/c1-10-4-2-7-12(8-10)14(9-13(14)15)11-5-3-6-11/h2,4,7-8,11,13H,3,5-6,9,15H2,1H3/t13-,14?/m1/s1 |
| InChIKey | CZVZEBGICBDVIM-KWCCSABGSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |