C16H22O — CID 105488570
[2-cyclopentyl-2-(3-methylphenyl)cyclopropyl]methanol (PubChem CID 105488570) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is [2-cyclopentyl-2-(3-methylphenyl)cyclopropyl]methanol.
| Compound Name | [2-cyclopentyl-2-(3-methylphenyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 105488570 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [2-cyclopentyl-2-(3-methylphenyl)cyclopropyl]methanol |
| SMILES | Cc1cccc(C2(C3CCCC3)CC2CO)c1 |
| InChI | InChI=1S/C16H22O/c1-12-5-4-8-14(9-12)16(10-15(16)11-17)13-6-2-3-7-13/h4-5,8-9,13,15,17H,2-3,6-7,10-11H2,1H3 |
| InChIKey | RPXQGTQNTPEYPZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |