C12H13NO2 — CID 105455209
6-methoxy-1,5-dimethylindole-2-carbaldehyde (PubChem CID 105455209) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 6-methoxy-1,5-dimethylindole-2-carbaldehyde.
| Compound Name | 6-methoxy-1,5-dimethylindole-2-carbaldehyde |
|---|---|
| PubChem CID | 105455209 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 6-methoxy-1,5-dimethylindole-2-carbaldehyde |
| SMILES | COc1cc2c(cc1C)cc(C=O)n2C |
| InChI | InChI=1S/C12H13NO2/c1-8-4-9-5-10(7-14)13(2)11(9)6-12(8)15-3/h4-7H,1-3H3 |
| InChIKey | MCUMYDMZKDLLFR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|