C21H17NO4 — CID 10545599
4-(3-carbazol-9-ylprop-1-ynyl)-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 10545599) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-(3-carbazol-9-ylprop-1-ynyl)-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-(3-carbazol-9-ylprop-1-ynyl)-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10545599 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-(3-carbazol-9-ylprop-1-ynyl)-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | COC1=C(OC)C(O)(C#CCn2c3ccccc3c3ccccc32)C1=O |
| InChI | InChI=1S/C21H17NO4/c1-25-18-19(23)21(24,20(18)26-2)12-7-13-22-16-10-5-3-8-14(16)15-9-4-6-11-17(15)22/h3-6,8-11,24H,13H2,1-2H3 |
| InChIKey | CJAGJHNKTRNMHK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|