C21H21NO3 — CID 139044978
5-(4,4-diethoxybut-2-ynyl)phenanthridin-6-one (PubChem CID 139044978) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 5-(4,4-diethoxybut-2-ynyl)phenanthridin-6-one.
| Compound Name | 5-(4,4-diethoxybut-2-ynyl)phenanthridin-6-one |
|---|---|
| PubChem CID | 139044978 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 5-(4,4-diethoxybut-2-ynyl)phenanthridin-6-one |
| SMILES | CCOC(C#CCn1c(=O)c2ccccc2c2ccccc21)OCC |
| InChI | InChI=1S/C21H21NO3/c1-3-24-20(25-4-2)14-9-15-22-19-13-8-7-11-17(19)16-10-5-6-12-18(16)21(22)23/h5-8,10-13,20H,3-4,15H2,1-2H3 |
| InChIKey | WHMDTJWEWTVMRP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|