C23H19N3O2 — CID 50941933
11,15-diethyl-11,13,15-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4,6,8,12,17,19,21-nonaene-10,16-dione (PubChem CID 50941933) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 11,15-diethyl-11,13,15-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4,6,8,12,17,19,21-nonaene-10,16-dione.
| Compound Name | 11,15-diethyl-11,13,15-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4,6,8,12,17,19,21-nonaene-10,16-dione |
|---|---|
| PubChem CID | 50941933 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 11,15-diethyl-11,13,15-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4,6,8,12,17,19,21-nonaene-10,16-dione |
| SMILES | CCn1c(=O)c2ccccc2c2cc3c4ccccc4c(=O)n(CC)c3nc21 |
| InChI | InChI=1S/C23H19N3O2/c1-3-25-20-18(14-9-5-7-11-16(14)22(25)27)13-19-15-10-6-8-12-17(15)23(28)26(4-2)21(19)24-20/h5-13H,3-4H2,1-2H3 |
| InChIKey | AWTWUFJJBKWAEM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|