C16H17N3O3 — CID 134998755
1,5-diethyl-3-methylpyrimido[5,4-c]isoquinoline-2,4,6-trione (PubChem CID 134998755) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1,5-diethyl-3-methylpyrimido[5,4-c]isoquinoline-2,4,6-trione.
| Compound Name | 1,5-diethyl-3-methylpyrimido[5,4-c]isoquinoline-2,4,6-trione |
|---|---|
| PubChem CID | 134998755 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1,5-diethyl-3-methylpyrimido[5,4-c]isoquinoline-2,4,6-trione |
| SMILES | CCn1c(=O)c2ccccc2c2c1c(=O)n(C)c(=O)n2CC |
| InChI | InChI=1S/C16H17N3O3/c1-4-18-13-12(10-8-6-7-9-11(10)14(18)20)19(5-2)16(22)17(3)15(13)21/h6-9H,4-5H2,1-3H3 |
| InChIKey | SMOBBLRHJGKYEU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|