C12H16N2O — CID 105456399
2-cyclobutyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde (PubChem CID 105456399) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-cyclobutyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde.
| Compound Name | 2-cyclobutyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105456399 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-cyclobutyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
| SMILES | O=Cc1c2c(nn1C1CCC1)CCCC2 |
| InChI | InChI=1S/C12H16N2O/c15-8-12-10-6-1-2-7-11(10)13-14(12)9-4-3-5-9/h8-9H,1-7H2 |
| InChIKey | XYWBJHBMBMRGHM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|