C13H19N3O — CID 105493367
1-piperidin-4-yl-4,5,6,7-tetrahydroindazole-3-carbaldehyde (PubChem CID 105493367) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-piperidin-4-yl-4,5,6,7-tetrahydroindazole-3-carbaldehyde.
| Compound Name | 1-piperidin-4-yl-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105493367 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-piperidin-4-yl-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
| SMILES | O=Cc1nn(C2CCNCC2)c2c1CCCC2 |
| InChI | InChI=1S/C13H19N3O/c17-9-12-11-3-1-2-4-13(11)16(15-12)10-5-7-14-8-6-10/h9-10,14H,1-8H2 |
| InChIKey | NVSJOKPCXPWVKI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|