About 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one
4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one (PubChem CID 105458761) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one |
| PubChem CID | 105458761 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one |
| SMILES | CN1CC(C)(c2ccccc2O)NC1=O |
| InChI | InChI=1S/C11H14N2O2/c1-11(7-13(2)10(15)12-11)8-5-3-4-6-9(8)14/h3-6,14H,7H2,1-2H3,(H,12,15) |
| InChIKey | DDBIHRKSIRSQRY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one?
The IUPAC name of 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one (CID 105458761) is 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one.
What is the SMILES notation for 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one?
The canonical SMILES for 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one is CN1CC(C)(c2ccccc2O)NC1=O.
What is the InChIKey of 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one?
The InChIKey is DDBIHRKSIRSQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-11(7-13(2)10(15)12-11)8-5-3-4-6-9(8)14/h3-6,14H,7H2,1-2H3,(H,12,15).
What are the key properties of 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one?
4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one has a molecular weight of 206.25 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyphenyl)-1,4-dimethylimidazolidin-2-one is sourced from PubChem (CID 105458761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).