C10H20N2O — CID 171546456
ethane;3-methyl-1,3-diazaspiro[4.4]nonan-2-one (PubChem CID 171546456) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is ethane;3-methyl-1,3-diazaspiro[4.4]nonan-2-one.
| Compound Name | ethane;3-methyl-1,3-diazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 171546456 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;3-methyl-1,3-diazaspiro[4.4]nonan-2-one |
| SMILES | CC.CN1CC2(CCCC2)NC1=O |
| InChI | InChI=1S/C8H14N2O.C2H6/c1-10-6-8(9-7(10)11)4-2-3-5-8;1-2/h2-6H2,1H3,(H,9,11);1-2H3 |
| InChIKey | LSQPGYWTJVBNMW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |