C10H20F2N2 — CID 105459094
3-(1-tert-butylazetidin-3-yl)-3,3-difluoropropan-1-amine (PubChem CID 105459094) has the molecular formula C10H20F2N2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 3-(1-tert-butylazetidin-3-yl)-3,3-difluoropropan-1-amine.
| Compound Name | 3-(1-tert-butylazetidin-3-yl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 105459094 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 3-(1-tert-butylazetidin-3-yl)-3,3-difluoropropan-1-amine |
| SMILES | CC(C)(C)N1CC(C(F)(F)CCN)C1 |
| InChI | InChI=1S/C10H20F2N2/c1-9(2,3)14-6-8(7-14)10(11,12)4-5-13/h8H,4-7,13H2,1-3H3 |
| InChIKey | ZUZHELYPLGYMNJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |