C11H13NO3 — CID 105460150
methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 105460150) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 105460150 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | COC(=O)C1CCOc2cccc(N)c21 |
| InChI | InChI=1S/C11H13NO3/c1-14-11(13)7-5-6-15-9-4-2-3-8(12)10(7)9/h2-4,7H,5-6,12H2,1H3 |
| InChIKey | DBBQNJCXKUFPGQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|