About methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate
methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 105460150) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate |
| PubChem CID | 105460150 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | COC(=O)C1CCOc2cccc(N)c21 |
| InChI | InChI=1S/C11H13NO3/c1-14-11(13)7-5-6-15-9-4-2-3-8(12)10(7)9/h2-4,7H,5-6,12H2,1H3 |
| InChIKey | DBBQNJCXKUFPGQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate?
The IUPAC name of methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate (CID 105460150) is methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate.
What is the SMILES notation for methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate?
The canonical SMILES for methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate is COC(=O)C1CCOc2cccc(N)c21.
What is the InChIKey of methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate?
The InChIKey is DBBQNJCXKUFPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-11(13)7-5-6-15-9-4-2-3-8(12)10(7)9/h2-4,7H,5-6,12H2,1H3.
What are the key properties of methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate?
methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-3,4-dihydro-2H-chromene-4-carboxylate is sourced from PubChem (CID 105460150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).