C10H13N3O2 — CID 105460208
4-(4-tert-butyl-1,3-oxazol-2-yl)-1,2-oxazol-5-amine (PubChem CID 105460208) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-(4-tert-butyl-1,3-oxazol-2-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(4-tert-butyl-1,3-oxazol-2-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 105460208 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-(4-tert-butyl-1,3-oxazol-2-yl)-1,2-oxazol-5-amine |
| SMILES | CC(C)(C)c1coc(-c2cnoc2N)n1 |
| InChI | InChI=1S/C10H13N3O2/c1-10(2,3)7-5-14-9(13-7)6-4-12-15-8(6)11/h4-5H,11H2,1-3H3 |
| InChIKey | GIIDRDRDFSQQTP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |