About methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate
methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate (PubChem CID 105465745) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate |
| PubChem CID | 105465745 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(N)noc1C1CCOC1 |
| InChI | InChI=1S/C9H12N2O4/c1-13-9(12)6-7(15-11-8(6)10)5-2-3-14-4-5/h5H,2-4H2,1H3,(H2,10,11) |
| InChIKey | PGVPGNORIMSYMA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate (CID 105465745) is methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate is COC(=O)c1c(N)noc1C1CCOC1.
What is the InChIKey of methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate?
The InChIKey is PGVPGNORIMSYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-13-9(12)6-7(15-11-8(6)10)5-2-3-14-4-5/h5H,2-4H2,1H3,(H2,10,11).
What are the key properties of methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate?
methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate has a molecular weight of 212.20 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-5-(oxolan-3-yl)-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 105465745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).