C7H9ClN2O2 — CID 105443368
3-chloro-4-(oxolan-3-yl)-1,2-oxazol-5-amine (PubChem CID 105443368) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is 3-chloro-4-(oxolan-3-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-chloro-4-(oxolan-3-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 105443368 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 3-chloro-4-(oxolan-3-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(Cl)c1C1CCOC1 |
| InChI | InChI=1S/C7H9ClN2O2/c8-6-5(7(9)12-10-6)4-1-2-11-3-4/h4H,1-3,9H2 |
| InChIKey | NMGZIVREIBNLBH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |