C10H20N4O — CID 105466236
2-(3-aminopropyl)-1,2,8-triazaspiro[4.5]decan-3-one (PubChem CID 105466236) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1,2,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2-(3-aminopropyl)-1,2,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 105466236 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-(3-aminopropyl)-1,2,8-triazaspiro[4.5]decan-3-one |
| SMILES | NCCCN1NC2(CCNCC2)CC1=O |
| InChI | InChI=1S/C10H20N4O/c11-4-1-7-14-9(15)8-10(13-14)2-5-12-6-3-10/h12-13H,1-8,11H2 |
| InChIKey | YOHAICODRISXTC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |