C7H12F2O3S — CID 105467505
1-(1,1-dioxothiolan-2-yl)-1,1-difluoropropan-2-ol (PubChem CID 105467505) has the molecular formula C7H12F2O3S and a molecular weight of 214.23 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-2-yl)-1,1-difluoropropan-2-ol.
| Compound Name | 1-(1,1-dioxothiolan-2-yl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 105467505 |
| Molecular Formula | C7H12F2O3S |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-(1,1-dioxothiolan-2-yl)-1,1-difluoropropan-2-ol |
| SMILES | CC(O)C(F)(F)C1CCCS1(=O)=O |
| InChI | InChI=1S/C7H12F2O3S/c1-5(10)7(8,9)6-3-2-4-13(6,11)12/h5-6,10H,2-4H2,1H3 |
| InChIKey | NORNKCBWNINJFA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |