About 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol
4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol (PubChem CID 105485479) has the molecular formula C8H14F2O3S
and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol |
| PubChem CID | 105485479 |
| Molecular Formula | C8H14F2O3S |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol |
| SMILES | CC(O)C(F)(F)CC1CCCS1(=O)=O |
| InChI | InChI=1S/C8H14F2O3S/c1-6(11)8(9,10)5-7-3-2-4-14(7,12)13/h6-7,11H,2-5H2,1H3 |
| InChIKey | FVUZPOHPSYXHEK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol?
The IUPAC name of 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol (CID 105485479) is 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol.
What is the SMILES notation for 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol?
The canonical SMILES for 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol is CC(O)C(F)(F)CC1CCCS1(=O)=O.
What is the InChIKey of 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol?
The InChIKey is FVUZPOHPSYXHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2O3S/c1-6(11)8(9,10)5-7-3-2-4-14(7,12)13/h6-7,11H,2-5H2,1H3.
What are the key properties of 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol?
4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol has a molecular weight of 228.26 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiolan-2-yl)-3,3-difluorobutan-2-ol is sourced from PubChem (CID 105485479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).