C9H16O4S — CID 84787514
2-(1,1-dioxothian-2-yl)-2-methylpropanoic acid (PubChem CID 84787514) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(1,1-dioxothian-2-yl)-2-methylpropanoic acid.
| Compound Name | 2-(1,1-dioxothian-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84787514 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(1,1-dioxothian-2-yl)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H16O4S/c1-9(2,8(10)11)7-5-3-4-6-14(7,12)13/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | QOKXHBCQEAXMHE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |