C10H19NO2 — CID 66887633
2-methyl-2-[(2R)-1-methylpiperidin-2-yl]propanoic acid (PubChem CID 66887633) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-methyl-2-[(2R)-1-methylpiperidin-2-yl]propanoic acid.
| Compound Name | 2-methyl-2-[(2R)-1-methylpiperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 66887633 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-methyl-2-[(2R)-1-methylpiperidin-2-yl]propanoic acid |
| SMILES | CN1CCCC[C@@H]1C(C)(C)C(=O)O |
| InChI | InChI=1S/C10H19NO2/c1-10(2,9(12)13)8-6-4-5-7-11(8)3/h8H,4-7H2,1-3H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | CZGRULLVYQAPMY-MRVPVSSYSA-N |
| XLogP | 1.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |