C19H40N2 — CID 156743098
2-tert-butyl-1-methylpiperidine;3-tert-butyl-1-methylpyrrolidine (PubChem CID 156743098) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 2-tert-butyl-1-methylpiperidine;3-tert-butyl-1-methylpyrrolidine.
| Compound Name | 2-tert-butyl-1-methylpiperidine;3-tert-butyl-1-methylpyrrolidine |
|---|---|
| PubChem CID | 156743098 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 2-tert-butyl-1-methylpiperidine;3-tert-butyl-1-methylpyrrolidine |
| SMILES | CN1CCC(C(C)(C)C)C1.CN1CCCCC1C(C)(C)C |
| InChI | InChI=1S/C10H21N.C9H19N/c1-10(2,3)9-7-5-6-8-11(9)4;1-9(2,3)8-5-6-10(4)7-8/h9H,5-8H2,1-4H3;8H,5-7H2,1-4H3 |
| InChIKey | KLCFXVBAXHUXFN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |