C12H14N4 — CID 105467862
3-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)aniline (PubChem CID 105467862) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)aniline.
| Compound Name | 3-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)aniline |
|---|---|
| PubChem CID | 105467862 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)aniline |
| SMILES | Nc1cccc(-n2ncc3c2CCNC3)c1 |
| InChI | InChI=1S/C12H14N4/c13-10-2-1-3-11(6-10)16-12-4-5-14-7-9(12)8-15-16/h1-3,6,8,14H,4-5,7,13H2 |
| InChIKey | MXNQTGWONIDYHG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|