About 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline
2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline (PubChem CID 105452879) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline.
Molecular Properties
| Compound Name | 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline |
| PubChem CID | 105452879 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline |
| SMILES | Nc1ccccc1-n1ncc2c1CNC2 |
| InChI | InChI=1S/C11H12N4/c12-9-3-1-2-4-10(9)15-11-7-13-5-8(11)6-14-15/h1-4,6,13H,5,7,12H2 |
| InChIKey | DYCQTQWYSCXHHH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline?
The IUPAC name of 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline (CID 105452879) is 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline.
What is the SMILES notation for 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline?
The canonical SMILES for 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline is Nc1ccccc1-n1ncc2c1CNC2.
What is the InChIKey of 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline?
The InChIKey is DYCQTQWYSCXHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c12-9-3-1-2-4-10(9)15-11-7-13-5-8(11)6-14-15/h1-4,6,13H,5,7,12H2.
What are the key properties of 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline?
2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline has a molecular weight of 200.25 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-1-yl)aniline is sourced from PubChem (CID 105452879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).