C12H13N3S — CID 105490024
2-(5,7-dihydro-4H-thiopyrano[4,3-d]pyrazol-1-yl)aniline (PubChem CID 105490024) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-(5,7-dihydro-4H-thiopyrano[4,3-d]pyrazol-1-yl)aniline.
| Compound Name | 2-(5,7-dihydro-4H-thiopyrano[4,3-d]pyrazol-1-yl)aniline |
|---|---|
| PubChem CID | 105490024 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-(5,7-dihydro-4H-thiopyrano[4,3-d]pyrazol-1-yl)aniline |
| SMILES | Nc1ccccc1-n1ncc2c1CSCC2 |
| InChI | InChI=1S/C12H13N3S/c13-10-3-1-2-4-11(10)15-12-8-16-6-5-9(12)7-14-15/h1-4,7H,5-6,8,13H2 |
| InChIKey | BRSQOWIFLNIVAG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|