C12H10F3N3 — CID 82586398
1-(2,3,4-trifluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine (PubChem CID 82586398) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine.
| Compound Name | 1-(2,3,4-trifluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 82586398 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine |
| SMILES | Fc1ccc(-n2ncc3c2CCNC3)c(F)c1F |
| InChI | InChI=1S/C12H10F3N3/c13-8-1-2-10(12(15)11(8)14)18-9-3-4-16-5-7(9)6-17-18/h1-2,6,16H,3-5H2 |
| InChIKey | JJSDNGGKMLVOIV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|