C18H31NO3Si2 — CID 10546821
methyl (2S,3R)-4-(benzylamino)-4-oxo-2,3-bis(trimethylsilyl)butanoate (PubChem CID 10546821) has the molecular formula C18H31NO3Si2 and a molecular weight of 365.62 g/mol. Its IUPAC name is methyl (2S,3R)-4-(benzylamino)-4-oxo-2,3-bis(trimethylsilyl)butanoate.
| Compound Name | methyl (2S,3R)-4-(benzylamino)-4-oxo-2,3-bis(trimethylsilyl)butanoate |
|---|---|
| PubChem CID | 10546821 |
| Molecular Formula | C18H31NO3Si2 |
| Molecular Weight | 365.62 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | methyl (2S,3R)-4-(benzylamino)-4-oxo-2,3-bis(trimethylsilyl)butanoate |
| SMILES | COC(=O)[C@@H]([C@@H](C(=O)NCc1ccccc1)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H31NO3Si2/c1-22-18(21)16(24(5,6)7)15(23(2,3)4)17(20)19-13-14-11-9-8-10-12-14/h8-12,15-16H,13H2,1-7H3,(H,19,20)/t15-,16+/m0/s1 |
| InChIKey | HFSOARVFXRIUQN-JKSUJKDBSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|