5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid

C13H13NO2 — CID 105468499

IUPAC5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid
SMILESCc1cccc2c1cc1n2C(C(=O)O)CC1
InChIInChI=1S/C13H13NO2/c1-8-3-2-4-11-10(8)7-9-5-6-12(13(15)16)14(9)11/h2-4,7,12H,5-6H2,1H3,(H,15,16)
InChIKeyQOGGWUIYCGJALU-UHFFFAOYSA-N
MW215.25 g/mol
LogP2.52
Rot. Bonds1

About 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid

5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid (PubChem CID 105468499) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid.

Molecular Properties

Compound Name5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid
PubChem CID105468499
Molecular FormulaC13H13NO2
Molecular Weight215.25 g/mol
Exact Mass215.09
IUPAC Name5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid
SMILESCc1cccc2c1cc1n2C(C(=O)O)CC1
InChIInChI=1S/C13H13NO2/c1-8-3-2-4-11-10(8)7-9-5-6-12(13(15)16)14(9)11/h2-4,7,12H,5-6H2,1H3,(H,15,16)
InChIKeyQOGGWUIYCGJALU-UHFFFAOYSA-N
XLogP2.52
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
The IUPAC name of 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid (CID 105468499) is 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid.
What is the SMILES notation for 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
The canonical SMILES for 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid is Cc1cccc2c1cc1n2C(C(=O)O)CC1.
What is the InChIKey of 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
The InChIKey is QOGGWUIYCGJALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c1-8-3-2-4-11-10(8)7-9-5-6-12(13(15)16)14(9)11/h2-4,7,12H,5-6H2,1H3,(H,15,16).
What are the key properties of 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid has a molecular weight of 215.25 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid is sourced from PubChem (CID 105468499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).