C10H14ClNO2 — CID 105469278
1-(2-amino-3-chlorophenyl)butane-1,4-diol (PubChem CID 105469278) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 1-(2-amino-3-chlorophenyl)butane-1,4-diol.
| Compound Name | 1-(2-amino-3-chlorophenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 105469278 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(2-amino-3-chlorophenyl)butane-1,4-diol |
| SMILES | Nc1c(Cl)cccc1C(O)CCCO |
| InChI | InChI=1S/C10H14ClNO2/c11-8-4-1-3-7(10(8)12)9(14)5-2-6-13/h1,3-4,9,13-14H,2,5-6,12H2 |
| InChIKey | MBFFDBUHEWPHFA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|