C13H16N2O — CID 105469893
1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine (PubChem CID 105469893) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine.
| Compound Name | 1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine |
|---|---|
| PubChem CID | 105469893 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine |
| SMILES | COc1cccc2c1cc1n2CCC(N)C1 |
| InChI | InChI=1S/C13H16N2O/c1-16-13-4-2-3-12-11(13)8-10-7-9(14)5-6-15(10)12/h2-4,8-9H,5-7,14H2,1H3 |
| InChIKey | APCXVRWXEQLZRV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |