C12H17NO3 — CID 66356674
3-(2,6-dimethoxyphenoxy)cyclobutan-1-amine (PubChem CID 66356674) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenoxy)cyclobutan-1-amine.
| Compound Name | 3-(2,6-dimethoxyphenoxy)cyclobutan-1-amine |
|---|---|
| PubChem CID | 66356674 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(2,6-dimethoxyphenoxy)cyclobutan-1-amine |
| SMILES | COc1cccc(OC)c1OC1CC(N)C1 |
| InChI | InChI=1S/C12H17NO3/c1-14-10-4-3-5-11(15-2)12(10)16-9-6-8(13)7-9/h3-5,8-9H,6-7,13H2,1-2H3 |
| InChIKey | OHFUBLSHERFIFF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |