About 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one
5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one (PubChem CID 19927834) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one.
Molecular Properties
| Compound Name | 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one |
| PubChem CID | 19927834 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one |
| SMILES | COc1cccc2c1cc1n2CCC1=O |
| InChI | InChI=1S/C12H11NO2/c1-15-12-4-2-3-9-8(12)7-10-11(14)5-6-13(9)10/h2-4,7H,5-6H2,1H3 |
| InChIKey | UGWKVCNCALVVHA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one?
The IUPAC name of 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one (CID 19927834) is 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one.
What is the SMILES notation for 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one?
The canonical SMILES for 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one is COc1cccc2c1cc1n2CCC1=O.
What is the InChIKey of 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one?
The InChIKey is UGWKVCNCALVVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c1-15-12-4-2-3-9-8(12)7-10-11(14)5-6-13(9)10/h2-4,7H,5-6H2,1H3.
What are the key properties of 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one?
5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one has a molecular weight of 201.23 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-dihydropyrrolo[1,2-a]indol-3-one is sourced from PubChem (CID 19927834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).