C11H14N2O — CID 45091447
4-methoxy-N,1-dimethylindol-2-amine (PubChem CID 45091447) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-methoxy-N,1-dimethylindol-2-amine.
| Compound Name | 4-methoxy-N,1-dimethylindol-2-amine |
|---|---|
| PubChem CID | 45091447 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-methoxy-N,1-dimethylindol-2-amine |
| SMILES | CNc1cc2c(OC)cccc2n1C |
| InChI | InChI=1S/C11H14N2O/c1-12-11-7-8-9(13(11)2)5-4-6-10(8)14-3/h4-7,12H,1-3H3 |
| InChIKey | AJYYPUCUWXNHFQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |