About N,1-dimethylindol-2-amine
N,1-dimethylindol-2-amine (PubChem CID 11744928) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is N,1-dimethylindol-2-amine.
Molecular Properties
| Compound Name | N,1-dimethylindol-2-amine |
| PubChem CID | 11744928 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N,1-dimethylindol-2-amine |
| SMILES | CNc1cc2ccccc2n1C |
| InChI | InChI=1S/C10H12N2/c1-11-10-7-8-5-3-4-6-9(8)12(10)2/h3-7,11H,1-2H3 |
| InChIKey | VHKURVOHTBCPID-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,1-dimethylindol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethylindol-2-amine?
The IUPAC name of N,1-dimethylindol-2-amine (CID 11744928) is N,1-dimethylindol-2-amine.
What is the SMILES notation for N,1-dimethylindol-2-amine?
The canonical SMILES for N,1-dimethylindol-2-amine is CNc1cc2ccccc2n1C.
What is the InChIKey of N,1-dimethylindol-2-amine?
The InChIKey is VHKURVOHTBCPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-11-10-7-8-5-3-4-6-9(8)12(10)2/h3-7,11H,1-2H3.
What are the key properties of N,1-dimethylindol-2-amine?
N,1-dimethylindol-2-amine has a molecular weight of 160.22 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethylindol-2-amine is sourced from PubChem (CID 11744928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).