C12H16N4 — CID 105470150
6-(piperidin-3-ylmethyl)imidazo[1,5-a]pyrimidine (PubChem CID 105470150) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 6-(piperidin-3-ylmethyl)imidazo[1,5-a]pyrimidine.
| Compound Name | 6-(piperidin-3-ylmethyl)imidazo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 105470150 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 6-(piperidin-3-ylmethyl)imidazo[1,5-a]pyrimidine |
| SMILES | c1cnc2cnc(CC3CCCNC3)n2c1 |
| InChI | InChI=1S/C12H16N4/c1-3-10(8-13-4-1)7-11-15-9-12-14-5-2-6-16(11)12/h2,5-6,9-10,13H,1,3-4,7-8H2 |
| InChIKey | VOLYGGNSMKQSBT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |