C11H15N5 — CID 62690462
3-(piperidin-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 62690462) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-(piperidin-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(piperidin-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 62690462 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-(piperidin-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | c1cn2c(CC3CCCNC3)nnc2cn1 |
| InChI | InChI=1S/C11H15N5/c1-2-9(7-12-3-1)6-10-14-15-11-8-13-4-5-16(10)11/h4-5,8-9,12H,1-3,6-7H2 |
| InChIKey | VUKTZUQRAIYNAY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |