C11H19N5 — CID 136758156
3-(piperidin-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 136758156) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 3-(piperidin-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrimidine.
| Compound Name | 3-(piperidin-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrimidine |
|---|---|
| PubChem CID | 136758156 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3-(piperidin-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrimidine |
| SMILES | C1CNCC(Cc2nnc3n2CCCN3)C1 |
| InChI | InChI=1S/C11H19N5/c1-3-9(8-12-4-1)7-10-14-15-11-13-5-2-6-16(10)11/h9,12H,1-8H2,(H,13,15) |
| InChIKey | ALZPASXUZUYJFO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |