C11H11N3O2 — CID 105470778
3,5-diamino-1-(3-hydroxyphenyl)pyridin-2-one (PubChem CID 105470778) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 3,5-diamino-1-(3-hydroxyphenyl)pyridin-2-one.
| Compound Name | 3,5-diamino-1-(3-hydroxyphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 105470778 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3,5-diamino-1-(3-hydroxyphenyl)pyridin-2-one |
| SMILES | Nc1cc(N)c(=O)n(-c2cccc(O)c2)c1 |
| InChI | InChI=1S/C11H11N3O2/c12-7-4-10(13)11(16)14(6-7)8-2-1-3-9(15)5-8/h1-6,15H,12-13H2 |
| InChIKey | KIMCODLHYFPUSB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |