C20H23N3O2S — CID 10547089
[4-amino-3-(6-hydroxy-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)phenyl]-phenylmethanone (PubChem CID 10547089) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is [4-amino-3-(6-hydroxy-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)phenyl]-phenylmethanone.
| Compound Name | [4-amino-3-(6-hydroxy-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 10547089 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [4-amino-3-(6-hydroxy-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)phenyl]-phenylmethanone |
| SMILES | CC1(C)CC(C)(O)N(c2cc(C(=O)c3ccccc3)ccc2N)C(=S)N1 |
| InChI | InChI=1S/C20H23N3O2S/c1-19(2)12-20(3,25)23(18(26)22-19)16-11-14(9-10-15(16)21)17(24)13-7-5-4-6-8-13/h4-11,25H,12,21H2,1-3H3,(H,22,26) |
| InChIKey | NQZIRZMEMJYEAV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|