C11H10FN3O — CID 105473582
2-[5-(2-fluorophenyl)-1,2,4-triazin-3-yl]ethanol (PubChem CID 105473582) has the molecular formula C11H10FN3O and a molecular weight of 219.22 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,2,4-triazin-3-yl]ethanol.
| Compound Name | 2-[5-(2-fluorophenyl)-1,2,4-triazin-3-yl]ethanol |
|---|---|
| PubChem CID | 105473582 |
| Molecular Formula | C11H10FN3O |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,2,4-triazin-3-yl]ethanol |
| SMILES | OCCc1nncc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C11H10FN3O/c12-9-4-2-1-3-8(9)10-7-13-15-11(14-10)5-6-16/h1-4,7,16H,5-6H2 |
| InChIKey | SPZBGFZOHOZUDC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |