C12H19N3O — CID 105477919
2-(5-cycloheptyl-1,2,4-triazin-3-yl)ethanol (PubChem CID 105477919) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(5-cycloheptyl-1,2,4-triazin-3-yl)ethanol.
| Compound Name | 2-(5-cycloheptyl-1,2,4-triazin-3-yl)ethanol |
|---|---|
| PubChem CID | 105477919 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(5-cycloheptyl-1,2,4-triazin-3-yl)ethanol |
| SMILES | OCCc1nncc(C2CCCCCC2)n1 |
| InChI | InChI=1S/C12H19N3O/c16-8-7-12-14-11(9-13-15-12)10-5-3-1-2-4-6-10/h9-10,16H,1-8H2 |
| InChIKey | IRZGMIXWVFBNPB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |