C13H17NO2 — CID 105474259
3-[(cyclopropylamino)methyl]-3,4-dihydro-2H-chromen-6-ol (PubChem CID 105474259) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[(cyclopropylamino)methyl]-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | 3-[(cyclopropylamino)methyl]-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 105474259 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-[(cyclopropylamino)methyl]-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1ccc2c(c1)CC(CNC1CC1)CO2 |
| InChI | InChI=1S/C13H17NO2/c15-12-3-4-13-10(6-12)5-9(8-16-13)7-14-11-1-2-11/h3-4,6,9,11,14-15H,1-2,5,7-8H2 |
| InChIKey | LKGQBUVIHXCWEB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |