C11H16N4O — CID 105475956
1-[5-(oxan-4-yl)-1,2,4-triazin-3-yl]cyclopropan-1-amine (PubChem CID 105475956) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-[5-(oxan-4-yl)-1,2,4-triazin-3-yl]cyclopropan-1-amine.
| Compound Name | 1-[5-(oxan-4-yl)-1,2,4-triazin-3-yl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 105475956 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[5-(oxan-4-yl)-1,2,4-triazin-3-yl]cyclopropan-1-amine |
| SMILES | NC1(c2nncc(C3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C11H16N4O/c12-11(3-4-11)10-14-9(7-13-15-10)8-1-5-16-6-2-8/h7-8H,1-6,12H2 |
| InChIKey | QQFZFADMSBPHKV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |