C8H12N4S — CID 105450174
5-(thian-4-yl)-1,2,4-triazin-3-amine (PubChem CID 105450174) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 5-(thian-4-yl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(thian-4-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105450174 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-(thian-4-yl)-1,2,4-triazin-3-amine |
| SMILES | Nc1nncc(C2CCSCC2)n1 |
| InChI | InChI=1S/C8H12N4S/c9-8-11-7(5-10-12-8)6-1-3-13-4-2-6/h5-6H,1-4H2,(H2,9,11,12) |
| InChIKey | HNKKQZQIQUJUOR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |