4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid

C11H11NO4 — CID 105477023

IUPAC4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid
SMILESCC1(c2ccc(C(=O)O)cc2)COC(=O)N1
InChIInChI=1S/C11H11NO4/c1-11(6-16-10(15)12-11)8-4-2-7(3-5-8)9(13)14/h2-5H,6H2,1H3,(H,12,15)(H,13,14)
InChIKeyDNEDVNHHIMVSGE-UHFFFAOYSA-N
MW221.21 g/mol
LogP1.34
Rot. Bonds2

About 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid

4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid (PubChem CID 105477023) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid.

Molecular Properties

Compound Name4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid
PubChem CID105477023
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid
SMILESCC1(c2ccc(C(=O)O)cc2)COC(=O)N1
InChIInChI=1S/C11H11NO4/c1-11(6-16-10(15)12-11)8-4-2-7(3-5-8)9(13)14/h2-5H,6H2,1H3,(H,12,15)(H,13,14)
InChIKeyDNEDVNHHIMVSGE-UHFFFAOYSA-N
XLogP1.34
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 51.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid?
The IUPAC name of 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid (CID 105477023) is 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid.
What is the SMILES notation for 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid?
The canonical SMILES for 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid is CC1(c2ccc(C(=O)O)cc2)COC(=O)N1.
What is the InChIKey of 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid?
The InChIKey is DNEDVNHHIMVSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-11(6-16-10(15)12-11)8-4-2-7(3-5-8)9(13)14/h2-5H,6H2,1H3,(H,12,15)(H,13,14).
What are the key properties of 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid?
4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid has a molecular weight of 221.21 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2-oxo-1,3-oxazolidin-4-yl)benzoic acid is sourced from PubChem (CID 105477023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).