C12H11ClO2 — CID 105479967
2-(5-chloro-3,4-dihydronaphthalen-1-yl)acetic acid (PubChem CID 105479967) has the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-(5-chloro-3,4-dihydronaphthalen-1-yl)acetic acid.
| Compound Name | 2-(5-chloro-3,4-dihydronaphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 105479967 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2-(5-chloro-3,4-dihydronaphthalen-1-yl)acetic acid |
| SMILES | O=C(O)CC1=CCCc2c(Cl)cccc21 |
| InChI | InChI=1S/C12H11ClO2/c13-11-6-2-4-9-8(7-12(14)15)3-1-5-10(9)11/h2-4,6H,1,5,7H2,(H,14,15) |
| InChIKey | SCDAEYMOPXWPGM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |