C17H13ClO2 — CID 115057864
5-chloro-1-phenyl-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 115057864) has the molecular formula C17H13ClO2 and a molecular weight of 284.74 g/mol. Its IUPAC name is 5-chloro-1-phenyl-3,4-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 5-chloro-1-phenyl-3,4-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 115057864 |
| Molecular Formula | C17H13ClO2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-chloro-1-phenyl-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(c2ccccc2)c2cccc(Cl)c2CC1 |
| InChI | InChI=1S/C17H13ClO2/c18-15-8-4-7-13-12(15)9-10-14(17(19)20)16(13)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,19,20) |
| InChIKey | UVUWQKYJHRFJQY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |