C13H10ClO2S+ — CID 172686874
6-chloro-4,5-dihydrobenzo[g][1]benzothiol-1-ium-1-carboxylic acid (PubChem CID 172686874) has the molecular formula C13H10ClO2S+ and a molecular weight of 265.74 g/mol. Its IUPAC name is 6-chloro-4,5-dihydrobenzo[g][1]benzothiol-1-ium-1-carboxylic acid.
| Compound Name | 6-chloro-4,5-dihydrobenzo[g][1]benzothiol-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 172686874 |
| Molecular Formula | C13H10ClO2S+ |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 6-chloro-4,5-dihydrobenzo[g][1]benzothiol-1-ium-1-carboxylic acid |
| SMILES | O=C(O)[s+]1ccc2c1-c1cccc(Cl)c1CC2 |
| InChI | InChI=1S/C13H9ClO2S/c14-11-3-1-2-10-9(11)5-4-8-6-7-17(12(8)10)13(15)16/h1-3,6-7H,4-5H2/p+1 |
| InChIKey | BDRBCENDUXULKU-UHFFFAOYSA-O |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|