C11H9ClO — CID 82277867
5-chloro-2-methylidene-3,4-dihydronaphthalen-1-one (PubChem CID 82277867) has the molecular formula C11H9ClO and a molecular weight of 192.65 g/mol. Its IUPAC name is 5-chloro-2-methylidene-3,4-dihydronaphthalen-1-one.
| Compound Name | 5-chloro-2-methylidene-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 82277867 |
| Molecular Formula | C11H9ClO |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 5-chloro-2-methylidene-3,4-dihydronaphthalen-1-one |
| SMILES | C=C1CCc2c(Cl)cccc2C1=O |
| InChI | InChI=1S/C11H9ClO/c1-7-5-6-8-9(11(7)13)3-2-4-10(8)12/h2-4H,1,5-6H2 |
| InChIKey | CCKQFXKAFZYMBD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|