C10H11N — CID 143813734
1-methylidene-2,3-dihydroinden-4-amine (PubChem CID 143813734) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 1-methylidene-2,3-dihydroinden-4-amine.
| Compound Name | 1-methylidene-2,3-dihydroinden-4-amine |
|---|---|
| PubChem CID | 143813734 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1-methylidene-2,3-dihydroinden-4-amine |
| SMILES | C=C1CCc2c(N)cccc21 |
| InChI | InChI=1S/C10H11N/c1-7-5-6-9-8(7)3-2-4-10(9)11/h2-4H,1,5-6,11H2 |
| InChIKey | PGDHEDAYGQFOHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|